C25H35F2NO2 — CID 11973743
3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N,N-diethylpropanamide (PubChem CID 11973743) has the molecular formula C25H35F2NO2 and a molecular weight of 419.56 g/mol. Its IUPAC name is 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N,N-diethylpropanamide.
| Compound Name | 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 11973743 |
| Molecular Formula | C25H35F2NO2 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 3-[(8R,9S,13S,14S,15R)-17,17-difluoro-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CC[C@@H]1CC(F)(F)[C@@]2(C)CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H35F2NO2/c1-4-28(5-2)22(30)11-7-17-15-25(26,27)24(3)13-12-20-19-10-8-18(29)14-16(19)6-9-21(20)23(17)24/h8,10,14,17,20-21,23,29H,4-7,9,11-13,15H2,1-3H3/t17-,20-,21-,23+,24+/m1/s1 |
| InChIKey | RJHDPDOXMZEXED-NCKWWWGNSA-N |
| XLogP | 5.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |