C17H24N2O3 — CID 119738178
ethyl 4-[[2-(4-aminophenyl)acetyl]amino]cyclohexane-1-carboxylate (PubChem CID 119738178) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is ethyl 4-[[2-(4-aminophenyl)acetyl]amino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-aminophenyl)acetyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 119738178 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | ethyl 4-[[2-(4-aminophenyl)acetyl]amino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NC(=O)Cc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-2-22-17(21)13-5-9-15(10-6-13)19-16(20)11-12-3-7-14(18)8-4-12/h3-4,7-8,13,15H,2,5-6,9-11,18H2,1H3,(H,19,20) |
| InChIKey | MPLRJUUKENRUBU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|