C14H25ClN2O3 — CID 119738217
ethyl 4-(pyrrolidine-3-carbonylamino)cyclohexane-1-carboxylate;hydrochloride (PubChem CID 119738217) has the molecular formula C14H25ClN2O3 and a molecular weight of 304.82 g/mol. Its IUPAC name is ethyl 4-(pyrrolidine-3-carbonylamino)cyclohexane-1-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(pyrrolidine-3-carbonylamino)cyclohexane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 119738217 |
| Molecular Formula | C14H25ClN2O3 |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | ethyl 4-(pyrrolidine-3-carbonylamino)cyclohexane-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1CCC(NC(=O)C2CCNC2)CC1.Cl |
| InChI | InChI=1S/C14H24N2O3.ClH/c1-2-19-14(18)10-3-5-12(6-4-10)16-13(17)11-7-8-15-9-11;/h10-12,15H,2-9H2,1H3,(H,16,17);1H |
| InChIKey | RGLNELHNVVFMSU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |