C25H34O4Si — CID 11973972
(2S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,3-dimethyloxan-4-one (PubChem CID 11973972) has the molecular formula C25H34O4Si and a molecular weight of 426.63 g/mol. Its IUPAC name is (2S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,3-dimethyloxan-4-one.
| Compound Name | (2S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,3-dimethyloxan-4-one |
|---|---|
| PubChem CID | 11973972 |
| Molecular Formula | C25H34O4Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | (2S,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxy-3,3-dimethyloxan-4-one |
| SMILES | CO[C@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC(=O)C1(C)C |
| InChI | InChI=1S/C25H34O4Si/c1-24(2,3)30(20-13-9-7-10-14-20,21-15-11-8-12-16-21)28-18-19-17-22(26)25(4,5)23(27-6)29-19/h7-16,19,23H,17-18H2,1-6H3/t19-,23-/m0/s1 |
| InChIKey | BMRMFIACGGIEQK-CVDCTZTESA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|