C20H26ClN3O2 — CID 119740914
N-[3-[(2-amino-3-methylpentanoyl)amino]-2-methylphenyl]benzamide;hydrochloride (PubChem CID 119740914) has the molecular formula C20H26ClN3O2 and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[3-[(2-amino-3-methylpentanoyl)amino]-2-methylphenyl]benzamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-3-methylpentanoyl)amino]-2-methylphenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119740914 |
| Molecular Formula | C20H26ClN3O2 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-[3-[(2-amino-3-methylpentanoyl)amino]-2-methylphenyl]benzamide;hydrochloride |
| SMILES | CCC(C)C(N)C(=O)Nc1cccc(NC(=O)c2ccccc2)c1C.Cl |
| InChI | InChI=1S/C20H25N3O2.ClH/c1-4-13(2)18(21)20(25)23-17-12-8-11-16(14(17)3)22-19(24)15-9-6-5-7-10-15;/h5-13,18H,4,21H2,1-3H3,(H,22,24)(H,23,25);1H |
| InChIKey | DOOFVCGCFZGKLZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |