About CID 11974164
CID 11974164 (PubChem CID 11974164) has the molecular formula C15H20AuClN2
and a molecular weight of 460.76 g/mol.
Molecular Properties
| Compound Name | CID 11974164 |
| PubChem CID | 11974164 |
| Molecular Formula | C15H20AuClN2 |
| Molecular Weight | 460.76 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | — |
| SMILES | CCCN1[C]N(c2c(C)cc(C)cc2C)C=C1.Cl[Au] |
| InChI | InChI=1S/C15H20N2.Au.ClH/c1-5-6-16-7-8-17(11-16)15-13(3)9-12(2)10-14(15)4;;/h7-10H,5-6H2,1-4H3;;1H/q;+1;/p-1 |
| InChIKey | OZLHYKVIFLUMAI-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 11974164 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11974164?
The IUPAC name of CID 11974164 (CID 11974164) is not available.
What is the SMILES notation for CID 11974164?
The canonical SMILES for CID 11974164 is CCCN1[C]N(c2c(C)cc(C)cc2C)C=C1.Cl[Au].
What is the InChIKey of CID 11974164?
The InChIKey is OZLHYKVIFLUMAI-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H20N2.Au.ClH/c1-5-6-16-7-8-17(11-16)15-13(3)9-12(2)10-14(15)4;;/h7-10H,5-6H2,1-4H3;;1H/q;+1;/p-1.
What are the key properties of CID 11974164?
CID 11974164 has a molecular weight of 460.76 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11974164 is sourced from PubChem (CID 11974164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).