C13H19BrClFN2O — CID 119742387
N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119742387) has the molecular formula C13H19BrClFN2O and a molecular weight of 353.66 g/mol. Its IUPAC name is N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119742387 |
| Molecular Formula | C13H19BrClFN2O |
| Molecular Weight | 353.66 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | N-[2-(3-bromo-4-fluorophenyl)ethyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NCCc1ccc(F)c(Br)c1.Cl |
| InChI | InChI=1S/C13H18BrFN2O.ClH/c1-9(8-16-2)13(18)17-6-5-10-3-4-12(15)11(14)7-10;/h3-4,7,9,16H,5-6,8H2,1-2H3,(H,17,18);1H |
| InChIKey | LRQQOHHYPCEMMW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.66 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |