About 6-butyl-6-methyl-2,3-dihydro-1H-pyridine
6-butyl-6-methyl-2,3-dihydro-1H-pyridine (PubChem CID 11974287) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 6-butyl-6-methyl-2,3-dihydro-1H-pyridine.
Molecular Properties
| Compound Name | 6-butyl-6-methyl-2,3-dihydro-1H-pyridine |
| PubChem CID | 11974287 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | 6-butyl-6-methyl-2,3-dihydro-1H-pyridine |
| SMILES | CCCCC1(C)C=CCCN1 |
| InChI | InChI=1S/C10H19N/c1-3-4-7-10(2)8-5-6-9-11-10/h5,8,11H,3-4,6-7,9H2,1-2H3 |
| InChIKey | BQDOZHSIVMVODR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-6-methyl-2,3-dihydro-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-6-methyl-2,3-dihydro-1H-pyridine?
The IUPAC name of 6-butyl-6-methyl-2,3-dihydro-1H-pyridine (CID 11974287) is 6-butyl-6-methyl-2,3-dihydro-1H-pyridine.
What is the SMILES notation for 6-butyl-6-methyl-2,3-dihydro-1H-pyridine?
The canonical SMILES for 6-butyl-6-methyl-2,3-dihydro-1H-pyridine is CCCCC1(C)C=CCCN1.
What is the InChIKey of 6-butyl-6-methyl-2,3-dihydro-1H-pyridine?
The InChIKey is BQDOZHSIVMVODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-3-4-7-10(2)8-5-6-9-11-10/h5,8,11H,3-4,6-7,9H2,1-2H3.
What are the key properties of 6-butyl-6-methyl-2,3-dihydro-1H-pyridine?
6-butyl-6-methyl-2,3-dihydro-1H-pyridine has a molecular weight of 153.27 g/mol, XLogP of 2.48, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-6-methyl-2,3-dihydro-1H-pyridine is sourced from PubChem (CID 11974287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).