C36H46 — CID 11974356
1,2,3,4,5,8-hexaethyl-6,7-bis(pent-2-ynyl)anthracene (PubChem CID 11974356) has the molecular formula C36H46 and a molecular weight of 478.76 g/mol. Its IUPAC name is 1,2,3,4,5,8-hexaethyl-6,7-bis(pent-2-ynyl)anthracene.
| Compound Name | 1,2,3,4,5,8-hexaethyl-6,7-bis(pent-2-ynyl)anthracene |
|---|---|
| PubChem CID | 11974356 |
| Molecular Formula | C36H46 |
| Molecular Weight | 478.76 g/mol |
| Exact Mass | 478.36 |
| IUPAC Name | 1,2,3,4,5,8-hexaethyl-6,7-bis(pent-2-ynyl)anthracene |
| SMILES | CCC#CCc1c(CC#CCC)c(CC)c2cc3c(CC)c(CC)c(CC)c(CC)c3cc2c1CC |
| InChI | InChI=1S/C36H46/c1-9-17-19-21-31-29(15-7)35-23-33-27(13-5)25(11-3)26(12-4)28(14-6)34(33)24-36(35)30(16-8)32(31)22-20-18-10-2/h23-24H,9-16,21-22H2,1-8H3 |
| InChIKey | MJCNEDNTRWWVHD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.76 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|