C12H19NO4 — CID 11974374
methyl (2S)-1-[(2R)-2-methyl-4-oxopentanoyl]pyrrolidine-2-carboxylate (PubChem CID 11974374) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl (2S)-1-[(2R)-2-methyl-4-oxopentanoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(2R)-2-methyl-4-oxopentanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11974374 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl (2S)-1-[(2R)-2-methyl-4-oxopentanoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1C(=O)[C@H](C)CC(C)=O |
| InChI | InChI=1S/C12H19NO4/c1-8(7-9(2)14)11(15)13-6-4-5-10(13)12(16)17-3/h8,10H,4-7H2,1-3H3/t8-,10+/m1/s1 |
| InChIKey | QAUIWAAUWJOKST-SCZZXKLOSA-N |
| XLogP | 0.77 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |