C16H25ClN2O2S — CID 119743910
N-(3-methylsulfinylphenyl)-3-piperidin-3-ylbutanamide;hydrochloride (PubChem CID 119743910) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is N-(3-methylsulfinylphenyl)-3-piperidin-3-ylbutanamide;hydrochloride.
| Compound Name | N-(3-methylsulfinylphenyl)-3-piperidin-3-ylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119743910 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(3-methylsulfinylphenyl)-3-piperidin-3-ylbutanamide;hydrochloride |
| SMILES | CC(CC(=O)Nc1cccc(S(C)=O)c1)C1CCCNC1.Cl |
| InChI | InChI=1S/C16H24N2O2S.ClH/c1-12(13-5-4-8-17-11-13)9-16(19)18-14-6-3-7-15(10-14)21(2)20;/h3,6-7,10,12-13,17H,4-5,8-9,11H2,1-2H3,(H,18,19);1H |
| InChIKey | ZWBBPUVEAKLFJR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |