C18H35N3O2 — CID 119743931
1-(7-aminoheptanoylamino)-N,N-diethylcyclohexane-1-carboxamide (PubChem CID 119743931) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is 1-(7-aminoheptanoylamino)-N,N-diethylcyclohexane-1-carboxamide.
| Compound Name | 1-(7-aminoheptanoylamino)-N,N-diethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119743931 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | 1-(7-aminoheptanoylamino)-N,N-diethylcyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(NC(=O)CCCCCCN)CCCCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-3-21(4-2)17(23)18(13-9-7-10-14-18)20-16(22)12-8-5-6-11-15-19/h3-15,19H2,1-2H3,(H,20,22) |
| InChIKey | ZCYZKJOVNXNGJP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|