C12H18O3 — CID 11974422
(2R,6S)-6-but-3-enyl-6-hydroxy-2-propan-2-ylpyran-3-one (PubChem CID 11974422) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (2R,6S)-6-but-3-enyl-6-hydroxy-2-propan-2-ylpyran-3-one.
| Compound Name | (2R,6S)-6-but-3-enyl-6-hydroxy-2-propan-2-ylpyran-3-one |
|---|---|
| PubChem CID | 11974422 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (2R,6S)-6-but-3-enyl-6-hydroxy-2-propan-2-ylpyran-3-one |
| SMILES | C=CCC[C@@]1(O)C=CC(=O)[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C12H18O3/c1-4-5-7-12(14)8-6-10(13)11(15-12)9(2)3/h4,6,8-9,11,14H,1,5,7H2,2-3H3/t11-,12+/m1/s1 |
| InChIKey | WFQDIPBNQFVPSG-NEPJUHHUSA-N |
| XLogP | 1.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|