C18H26ClFN4O — CID 119744579
N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-4-(methylamino)butanamide;hydrochloride (PubChem CID 119744579) has the molecular formula C18H26ClFN4O and a molecular weight of 368.88 g/mol. Its IUPAC name is N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119744579 |
| Molecular Formula | C18H26ClFN4O |
| Molecular Weight | 368.88 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[3-[3-(3-fluorophenyl)-1H-pyrazol-5-yl]propyl]-N-methyl-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)N(C)CCCc1cc(-c2cccc(F)c2)n[nH]1.Cl |
| InChI | InChI=1S/C18H25FN4O.ClH/c1-20-10-4-9-18(24)23(2)11-5-8-16-13-17(22-21-16)14-6-3-7-15(19)12-14;/h3,6-7,12-13,20H,4-5,8-11H2,1-2H3,(H,21,22);1H |
| InChIKey | YKIJHYSSZHEZIW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|