C15H18N4O — CID 119744676
1-amino-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxamide (PubChem CID 119744676) has the molecular formula C15H18N4O and a molecular weight of 270.34 g/mol. Its IUPAC name is 1-amino-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119744676 |
| Molecular Formula | C15H18N4O |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-amino-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]cyclopropane-1-carboxamide |
| SMILES | NC1(C(=O)NCc2cccc(Cn3cccn3)c2)CC1 |
| InChI | InChI=1S/C15H18N4O/c16-15(5-6-15)14(20)17-10-12-3-1-4-13(9-12)11-19-8-2-7-18-19/h1-4,7-9H,5-6,10-11,16H2,(H,17,20) |
| InChIKey | IXZNIXXISZCVHD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |