C8H12F2N4OS — CID 119745205
N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-(methylamino)butanamide (PubChem CID 119745205) has the molecular formula C8H12F2N4OS and a molecular weight of 250.27 g/mol. Its IUPAC name is N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-(methylamino)butanamide.
| Compound Name | N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119745205 |
| Molecular Formula | C8H12F2N4OS |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | N-[5-(difluoromethyl)-1,3,4-thiadiazol-2-yl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)Nc1nnc(C(F)F)s1 |
| InChI | InChI=1S/C8H12F2N4OS/c1-11-4-2-3-5(15)12-8-14-13-7(16-8)6(9)10/h6,11H,2-4H2,1H3,(H,12,14,15) |
| InChIKey | LSPPGFGALKMTGL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|