C42H50O4 — CID 11974568
dimethyl 1,4,6,13-tetrabutylpentacene-2,3-dicarboxylate (PubChem CID 11974568) has the molecular formula C42H50O4 and a molecular weight of 618.86 g/mol. Its IUPAC name is dimethyl 1,4,6,13-tetrabutylpentacene-2,3-dicarboxylate.
| Compound Name | dimethyl 1,4,6,13-tetrabutylpentacene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11974568 |
| Molecular Formula | C42H50O4 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.37 |
| IUPAC Name | dimethyl 1,4,6,13-tetrabutylpentacene-2,3-dicarboxylate |
| SMILES | CCCCc1c(C(=O)OC)c(C(=O)OC)c(CCCC)c2cc3c(CCCC)c4cc5ccccc5cc4c(CCCC)c3cc12 |
| InChI | InChI=1S/C42H50O4/c1-7-11-19-29-33-23-27-17-15-16-18-28(27)24-34(33)30(20-12-8-2)36-26-38-32(22-14-10-4)40(42(44)46-6)39(41(43)45-5)31(21-13-9-3)37(38)25-35(29)36/h15-18,23-26H,7-14,19-22H2,1-6H3 |
| InChIKey | ILIOCRVQXNPVAA-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|