C14H2Cl2O6 — CID 11974757
2,9-dichloro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone (PubChem CID 11974757) has the molecular formula C14H2Cl2O6 and a molecular weight of 337.07 g/mol. Its IUPAC name is 2,9-dichloro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone.
| Compound Name | 2,9-dichloro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 11974757 |
| Molecular Formula | C14H2Cl2O6 |
| Molecular Weight | 337.07 g/mol |
| Exact Mass | 335.92 |
| IUPAC Name | 2,9-dichloro-6,13-dioxatetracyclo[6.6.2.04,16.011,15]hexadeca-1,3,8,10,15-pentaene-5,7,12,14-tetrone |
| SMILES | O=C1OC(=O)c2c(Cl)cc3c4c(c(Cl)cc1c24)C(=O)OC3=O |
| InChI | InChI=1S/C14H2Cl2O6/c15-5-1-3-7-8-4(12(18)22-13(19)9(5)8)2-6(16)10(7)14(20)21-11(3)17/h1-2H |
| InChIKey | AALYFHQGVHHUFJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.07 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|