About N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride
N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119748919) has the molecular formula C10H16ClF3N2O2
and a molecular weight of 288.70 g/mol. Its IUPAC name is N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride |
| PubChem CID | 119748919 |
| Molecular Formula | C10H16ClF3N2O2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride |
| SMILES | C=CCN(CC(F)(F)F)C(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C10H15F3N2O2.ClH/c1-2-4-15(7-10(11,12)13)9(16)8-6-14-3-5-17-8;/h2,8,14H,1,3-7H2;1H |
| InChIKey | SXUNUHWUXRCXDH-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride?
The IUPAC name of N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride (CID 119748919) is N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride.
What is the SMILES notation for N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride?
The canonical SMILES for N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride is C=CCN(CC(F)(F)F)C(=O)C1CNCCO1.Cl.
What is the InChIKey of N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride?
The InChIKey is SXUNUHWUXRCXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3N2O2.ClH/c1-2-4-15(7-10(11,12)13)9(16)8-6-14-3-5-17-8;/h2,8,14H,1,3-7H2;1H.
What are the key properties of N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride?
N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride has a molecular weight of 288.70 g/mol, XLogP of 0.97, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-N-(2,2,2-trifluoroethyl)morpholine-2-carboxamide;hydrochloride is sourced from PubChem (CID 119748919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).