C17H16N2O4 — CID 11974894
methyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate (PubChem CID 11974894) has the molecular formula C17H16N2O4 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate.
| Compound Name | methyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate |
|---|---|
| PubChem CID | 11974894 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | methyl 2,6-dioxo-1,7-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-10(17),11,13,15-tetraene-5-carboxylate |
| SMILES | COC(=O)C12CCC(=O)n3c1c(c1ccccc13)CCNC2=O |
| InChI | InChI=1S/C17H16N2O4/c1-23-16(22)17-8-6-13(20)19-12-5-3-2-4-10(12)11(14(17)19)7-9-18-15(17)21/h2-5H,6-9H2,1H3,(H,18,21) |
| InChIKey | HUBZFUSSMGOCRO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|