C23H24N2O — CID 119749324
2-(4-aminophenyl)-N-cyclopropyl-N-(1-naphthalen-2-ylethyl)acetamide (PubChem CID 119749324) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-cyclopropyl-N-(1-naphthalen-2-ylethyl)acetamide.
| Compound Name | 2-(4-aminophenyl)-N-cyclopropyl-N-(1-naphthalen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 119749324 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | 2-(4-aminophenyl)-N-cyclopropyl-N-(1-naphthalen-2-ylethyl)acetamide |
| SMILES | CC(c1ccc2ccccc2c1)N(C(=O)Cc1ccc(N)cc1)C1CC1 |
| InChI | InChI=1S/C23H24N2O/c1-16(19-9-8-18-4-2-3-5-20(18)15-19)25(22-12-13-22)23(26)14-17-6-10-21(24)11-7-17/h2-11,15-16,22H,12-14,24H2,1H3 |
| InChIKey | FSHGGQNJWTZKJX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|