C19H12Cl2N2O2 — CID 11975007
5,7-bis(4-chlorophenyl)-3,5-dihydropyrano[2,3-d]pyrimidin-4-one (PubChem CID 11975007) has the molecular formula C19H12Cl2N2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is 5,7-bis(4-chlorophenyl)-3,5-dihydropyrano[2,3-d]pyrimidin-4-one.
| Compound Name | 5,7-bis(4-chlorophenyl)-3,5-dihydropyrano[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11975007 |
| Molecular Formula | C19H12Cl2N2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 5,7-bis(4-chlorophenyl)-3,5-dihydropyrano[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1C(c1ccc(Cl)cc1)C=C(c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C19H12Cl2N2O2/c20-13-5-1-11(2-6-13)15-9-16(12-3-7-14(21)8-4-12)25-19-17(15)18(24)22-10-23-19/h1-10,15H,(H,22,23,24) |
| InChIKey | HSUTWJUFRZDGAA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |