C34H44O4 — CID 11975031
cis-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R)-2-oxo-5-(5-phenylmethoxypent-1-en-2-yl)cyclopentane-1-carboxylate (PubChem CID 11975031) has the molecular formula C34H44O4 and a molecular weight of 516.72 g/mol. Its IUPAC name is cis-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R)-2-oxo-5-(5-phenylmethoxypent-1-en-2-yl)cyclopentane-1-carboxylate.
| Compound Name | cis-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R)-2-oxo-5-(5-phenylmethoxypent-1-en-2-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 11975031 |
| Molecular Formula | C34H44O4 |
| Molecular Weight | 516.72 g/mol |
| Exact Mass | 516.32 |
| IUPAC Name | cis-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (1S,5R)-2-oxo-5-(5-phenylmethoxypent-1-en-2-yl)cyclopentane-1-carboxylate |
| SMILES | C=C(CCCOCc1ccccc1)[C@@H]1CCC(=O)[C@H]1C(=O)O[C@@H]1C[C@H](C)CC[C@H]1C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C34H44O4/c1-24-17-19-29(34(3,4)27-15-9-6-10-16-27)31(22-24)38-33(36)32-28(18-20-30(32)35)25(2)12-11-21-37-23-26-13-7-5-8-14-26/h5-10,13-16,24,28-29,31-32H,2,11-12,17-23H2,1,3-4H3/t24-,28+,29-,31-,32+/m1/s1 |
| InChIKey | MMTQYVUBIIBPQO-MLBANLTDSA-N |
| XLogP | 7.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.72 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|