About cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one
cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one (PubChem CID 11975032) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one.
Molecular Properties
| Compound Name | cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one |
| PubChem CID | 11975032 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one |
| SMILES | C=C(CCCOCc1ccccc1)[C@@H]1CCC(=O)[C@H]1C |
| InChI | InChI=1S/C18H24O2/c1-14(17-10-11-18(19)15(17)2)7-6-12-20-13-16-8-4-3-5-9-16/h3-5,8-9,15,17H,1,6-7,10-13H2,2H3/t15-,17-/m0/s1 |
| InChIKey | YNSNKOUXOWVCQW-RDJZCZTQSA-N |
| XLogP | 4.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one?
The IUPAC name of cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one (CID 11975032) is cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one.
What is the SMILES notation for cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one?
The canonical SMILES for cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one is C=C(CCCOCc1ccccc1)[C@@H]1CCC(=O)[C@H]1C.
What is the InChIKey of cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one?
The InChIKey is YNSNKOUXOWVCQW-RDJZCZTQSA-N. The full InChI is InChI=1S/C18H24O2/c1-14(17-10-11-18(19)15(17)2)7-6-12-20-13-16-8-4-3-5-9-16/h3-5,8-9,15,17H,1,6-7,10-13H2,2H3/t15-,17-/m0/s1.
What are the key properties of cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one?
cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one has a molecular weight of 272.39 g/mol, XLogP of 4.15, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,3R)-2-methyl-3-(5-phenylmethoxypent-1-en-2-yl)cyclopentan-1-one is sourced from PubChem (CID 11975032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).