C18H28ClN3O2 — CID 119750884
3-amino-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119750884) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-amino-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119750884 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-amino-N-[2-[benzyl(ethyl)amino]-2-oxoethyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCN(Cc1ccccc1)C(=O)CNC(=O)C1CCCC(N)C1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-2-21(13-14-7-4-3-5-8-14)17(22)12-20-18(23)15-9-6-10-16(19)11-15;/h3-5,7-8,15-16H,2,6,9-13,19H2,1H3,(H,20,23);1H |
| InChIKey | DBILMBBKTIDUDX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |