C17H27N3O2 — CID 119750951
7-amino-N-[1-(benzylamino)-1-oxopropan-2-yl]heptanamide (PubChem CID 119750951) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is 7-amino-N-[1-(benzylamino)-1-oxopropan-2-yl]heptanamide.
| Compound Name | 7-amino-N-[1-(benzylamino)-1-oxopropan-2-yl]heptanamide |
|---|---|
| PubChem CID | 119750951 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 7-amino-N-[1-(benzylamino)-1-oxopropan-2-yl]heptanamide |
| SMILES | CC(NC(=O)CCCCCCN)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C17H27N3O2/c1-14(20-16(21)11-7-2-3-8-12-18)17(22)19-13-15-9-5-4-6-10-15/h4-6,9-10,14H,2-3,7-8,11-13,18H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | VCJKTPDSRRYNEV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|