C17H27ClN2O2 — CID 119751564
2-methyl-3-(methylamino)-1-[4-(phenoxymethyl)piperidin-1-yl]propan-1-one;hydrochloride (PubChem CID 119751564) has the molecular formula C17H27ClN2O2 and a molecular weight of 326.87 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-1-[4-(phenoxymethyl)piperidin-1-yl]propan-1-one;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-1-[4-(phenoxymethyl)piperidin-1-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119751564 |
| Molecular Formula | C17H27ClN2O2 |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-methyl-3-(methylamino)-1-[4-(phenoxymethyl)piperidin-1-yl]propan-1-one;hydrochloride |
| SMILES | CNCC(C)C(=O)N1CCC(COc2ccccc2)CC1.Cl |
| InChI | InChI=1S/C17H26N2O2.ClH/c1-14(12-18-2)17(20)19-10-8-15(9-11-19)13-21-16-6-4-3-5-7-16;/h3-7,14-15,18H,8-13H2,1-2H3;1H |
| InChIKey | CSBDCXDWRHEOTJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |