C19H23ClN2O4 — CID 119752196
methyl 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]-5-methoxybenzoate;hydrochloride (PubChem CID 119752196) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is methyl 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]-5-methoxybenzoate;hydrochloride.
| Compound Name | methyl 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]-5-methoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 119752196 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methyl 2-[(3-amino-2-methyl-3-phenylpropanoyl)amino]-5-methoxybenzoate;hydrochloride |
| SMILES | COC(=O)c1cc(OC)ccc1NC(=O)C(C)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C19H22N2O4.ClH/c1-12(17(20)13-7-5-4-6-8-13)18(22)21-16-10-9-14(24-2)11-15(16)19(23)25-3;/h4-12,17H,20H2,1-3H3,(H,21,22);1H |
| InChIKey | CWMGHDPSXAMHHO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |