C19H21ClN4O2 — CID 119752578
N-[4-[(4-chlorophenyl)carbamoylamino]phenyl]-2-(cyclopropylmethylamino)acetamide (PubChem CID 119752578) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is N-[4-[(4-chlorophenyl)carbamoylamino]phenyl]-2-(cyclopropylmethylamino)acetamide.
| Compound Name | N-[4-[(4-chlorophenyl)carbamoylamino]phenyl]-2-(cyclopropylmethylamino)acetamide |
|---|---|
| PubChem CID | 119752578 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | N-[4-[(4-chlorophenyl)carbamoylamino]phenyl]-2-(cyclopropylmethylamino)acetamide |
| SMILES | O=C(CNCC1CC1)Nc1ccc(NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H21ClN4O2/c20-14-3-5-16(6-4-14)23-19(26)24-17-9-7-15(8-10-17)22-18(25)12-21-11-13-1-2-13/h3-10,13,21H,1-2,11-12H2,(H,22,25)(H2,23,24,26) |
| InChIKey | JOKSBKOLKUYEPZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |