C13H20BrClN2O — CID 119753158
N-[1-(4-bromophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride (PubChem CID 119753158) has the molecular formula C13H20BrClN2O and a molecular weight of 335.67 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-[1-(4-bromophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119753158 |
| Molecular Formula | C13H20BrClN2O |
| Molecular Weight | 335.67 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | N-[1-(4-bromophenyl)ethyl]-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC(C)c1ccc(Br)cc1.Cl |
| InChI | InChI=1S/C13H19BrN2O.ClH/c1-10(11-5-7-12(14)8-6-11)16-13(17)4-3-9-15-2;/h5-8,10,15H,3-4,9H2,1-2H3,(H,16,17);1H |
| InChIKey | LUZMPELKAGTQGM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.67 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|