C19H24Cl2N2O3 — CID 119753562
3-amino-N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-methyl-3-phenylpropanamide;hydrochloride (PubChem CID 119753562) has the molecular formula C19H24Cl2N2O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 3-amino-N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-methyl-3-phenylpropanamide;hydrochloride.
| Compound Name | 3-amino-N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-methyl-3-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 119753562 |
| Molecular Formula | C19H24Cl2N2O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-amino-N-[3-chloro-2-(2-methoxyethoxy)phenyl]-2-methyl-3-phenylpropanamide;hydrochloride |
| SMILES | COCCOc1c(Cl)cccc1NC(=O)C(C)C(N)c1ccccc1.Cl |
| InChI | InChI=1S/C19H23ClN2O3.ClH/c1-13(17(21)14-7-4-3-5-8-14)19(23)22-16-10-6-9-15(20)18(16)25-12-11-24-2;/h3-10,13,17H,11-12,21H2,1-2H3,(H,22,23);1H |
| InChIKey | MQEBBBNURQKGTJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|