C13H16BrClN2O — CID 119753695
N-[(4-bromo-2-chlorophenyl)methyl]-2-pyrrolidin-2-ylacetamide (PubChem CID 119753695) has the molecular formula C13H16BrClN2O and a molecular weight of 331.64 g/mol. Its IUPAC name is N-[(4-bromo-2-chlorophenyl)methyl]-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-[(4-bromo-2-chlorophenyl)methyl]-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119753695 |
| Molecular Formula | C13H16BrClN2O |
| Molecular Weight | 331.64 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-[(4-bromo-2-chlorophenyl)methyl]-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)NCc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H16BrClN2O/c14-10-4-3-9(12(15)6-10)8-17-13(18)7-11-2-1-5-16-11/h3-4,6,11,16H,1-2,5,7-8H2,(H,17,18) |
| InChIKey | DXYBCGUMTYMJGX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.64 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |