C20H25ClN2O2 — CID 119754368
2-(cyclopropylmethylamino)-N-[2-(2-phenylphenoxy)ethyl]acetamide;hydrochloride (PubChem CID 119754368) has the molecular formula C20H25ClN2O2 and a molecular weight of 360.88 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[2-(2-phenylphenoxy)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-[2-(2-phenylphenoxy)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119754368 |
| Molecular Formula | C20H25ClN2O2 |
| Molecular Weight | 360.88 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[2-(2-phenylphenoxy)ethyl]acetamide;hydrochloride |
| SMILES | Cl.O=C(CNCC1CC1)NCCOc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2.ClH/c23-20(15-21-14-16-10-11-16)22-12-13-24-19-9-5-4-8-18(19)17-6-2-1-3-7-17;/h1-9,16,21H,10-15H2,(H,22,23);1H |
| InChIKey | HQHCBLIESSMPQL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.88 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|