About tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate
tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate (PubChem CID 11975534) has the molecular formula C31H29NO2S
and a molecular weight of 479.65 g/mol. Its IUPAC name is tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate |
| PubChem CID | 11975534 |
| Molecular Formula | C31H29NO2S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(Cc2ccc3ccccc3c2)CSC(c2ccccc2-c2ccccc2)=N1 |
| InChI | InChI=1S/C31H29NO2S/c1-30(2,3)34-29(33)31(20-22-17-18-23-11-7-8-14-25(23)19-22)21-35-28(32-31)27-16-10-9-15-26(27)24-12-5-4-6-13-24/h4-19H,20-21H2,1-3H3/t31-/m1/s1 |
| InChIKey | JQPGENHYDGAOIJ-WJOKGBTCSA-N |
| XLogP | 7.32 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate?
The IUPAC name of tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate (CID 11975534) is tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate.
What is the SMILES notation for tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate?
The canonical SMILES for tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate is CC(C)(C)OC(=O)[C@@]1(Cc2ccc3ccccc3c2)CSC(c2ccccc2-c2ccccc2)=N1.
What is the InChIKey of tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate?
The InChIKey is JQPGENHYDGAOIJ-WJOKGBTCSA-N. The full InChI is InChI=1S/C31H29NO2S/c1-30(2,3)34-29(33)31(20-22-17-18-23-11-7-8-14-25(23)19-22)21-35-28(32-31)27-16-10-9-15-26(27)24-12-5-4-6-13-24/h4-19H,20-21H2,1-3H3/t31-/m1/s1.
What are the key properties of tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate?
tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate has a molecular weight of 479.65 g/mol, XLogP of 7.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4S)-4-(naphthalen-2-ylmethyl)-2-(2-phenylphenyl)-5H-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 11975534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).