C21H34N2O2 — CID 119756066
N-(2-methoxyethyl)-N-(3-phenylpropyl)-3-piperidin-3-ylbutanamide (PubChem CID 119756066) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-(3-phenylpropyl)-3-piperidin-3-ylbutanamide.
| Compound Name | N-(2-methoxyethyl)-N-(3-phenylpropyl)-3-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119756066 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | N-(2-methoxyethyl)-N-(3-phenylpropyl)-3-piperidin-3-ylbutanamide |
| SMILES | COCCN(CCCc1ccccc1)C(=O)CC(C)C1CCCNC1 |
| InChI | InChI=1S/C21H34N2O2/c1-18(20-11-6-12-22-17-20)16-21(24)23(14-15-25-2)13-7-10-19-8-4-3-5-9-19/h3-5,8-9,18,20,22H,6-7,10-17H2,1-2H3 |
| InChIKey | JVSJVZKTLXILHR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |