C15H23ClN2OS — CID 119756545
3-amino-2-phenyl-N-(thian-4-ylmethyl)propanamide;hydrochloride (PubChem CID 119756545) has the molecular formula C15H23ClN2OS and a molecular weight of 314.88 g/mol. Its IUPAC name is 3-amino-2-phenyl-N-(thian-4-ylmethyl)propanamide;hydrochloride.
| Compound Name | 3-amino-2-phenyl-N-(thian-4-ylmethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119756545 |
| Molecular Formula | C15H23ClN2OS |
| Molecular Weight | 314.88 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 3-amino-2-phenyl-N-(thian-4-ylmethyl)propanamide;hydrochloride |
| SMILES | Cl.NCC(C(=O)NCC1CCSCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2OS.ClH/c16-10-14(13-4-2-1-3-5-13)15(18)17-11-12-6-8-19-9-7-12;/h1-5,12,14H,6-11,16H2,(H,17,18);1H |
| InChIKey | NDALJDJIZJMFFE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |