C15H24Cl2N2O — CID 119756947
N-[2-(3-chlorophenyl)-2-methylpropyl]-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119756947) has the molecular formula C15H24Cl2N2O and a molecular weight of 319.28 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-methylpropyl]-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-[2-(3-chlorophenyl)-2-methylpropyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119756947 |
| Molecular Formula | C15H24Cl2N2O |
| Molecular Weight | 319.28 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-methylpropyl]-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NCC(C)(C)c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C15H23ClN2O.ClH/c1-11(9-17-4)14(19)18-10-15(2,3)12-6-5-7-13(16)8-12;/h5-8,11,17H,9-10H2,1-4H3,(H,18,19);1H |
| InChIKey | XVRYXKSPJWROCE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |