C19H22N2O2 — CID 119758146
3-amino-N-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]butanamide (PubChem CID 119758146) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-amino-N-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]butanamide.
| Compound Name | 3-amino-N-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 119758146 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 3-amino-N-[[4-(2,3-dihydro-1-benzofuran-5-yl)phenyl]methyl]butanamide |
| SMILES | CC(N)CC(=O)NCc1ccc(-c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C19H22N2O2/c1-13(20)10-19(22)21-12-14-2-4-15(5-3-14)16-6-7-18-17(11-16)8-9-23-18/h2-7,11,13H,8-10,12,20H2,1H3,(H,21,22) |
| InChIKey | HONPZVDOPNWNBZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |