C13H14O5 — CID 11975861
(1R,2R,6S,7S,8R,12S)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-9,11-dione (PubChem CID 11975861) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1R,2R,6S,7S,8R,12S)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-9,11-dione.
| Compound Name | (1R,2R,6S,7S,8R,12S)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-9,11-dione |
|---|---|
| PubChem CID | 11975861 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (1R,2R,6S,7S,8R,12S)-4,4-dimethyl-3,5,10-trioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-9,11-dione |
| SMILES | CC1(C)O[C@@H]2[C@@H]3C=C[C@H]([C@@H]2O1)[C@H]1C(=O)OC(=O)[C@@H]31 |
| InChI | InChI=1S/C13H14O5/c1-13(2)17-9-5-3-4-6(10(9)18-13)8-7(5)11(14)16-12(8)15/h3-10H,1-2H3/t5-,6+,7+,8-,9-,10+ |
| InChIKey | LHNSAPJQGQBISO-UXAOAXNSSA-N |
| XLogP | 0.64 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|