C14H20F4O4 — CID 11975878
(2R,4R,5S)-5-but-3-enyl-2,4-bis(difluoromethyl)-2-[(1R)-1-hydroxypent-4-enyl]-1,3-dioxolan-4-ol (PubChem CID 11975878) has the molecular formula C14H20F4O4 and a molecular weight of 328.30 g/mol. Its IUPAC name is (2R,4R,5S)-5-but-3-enyl-2,4-bis(difluoromethyl)-2-[(1R)-1-hydroxypent-4-enyl]-1,3-dioxolan-4-ol.
| Compound Name | (2R,4R,5S)-5-but-3-enyl-2,4-bis(difluoromethyl)-2-[(1R)-1-hydroxypent-4-enyl]-1,3-dioxolan-4-ol |
|---|---|
| PubChem CID | 11975878 |
| Molecular Formula | C14H20F4O4 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (2R,4R,5S)-5-but-3-enyl-2,4-bis(difluoromethyl)-2-[(1R)-1-hydroxypent-4-enyl]-1,3-dioxolan-4-ol |
| SMILES | C=CCC[C@@H](O)[C@@]1(C(F)F)O[C@@H](CCC=C)[C@](O)(C(F)F)O1 |
| InChI | InChI=1S/C14H20F4O4/c1-3-5-7-9(19)14(12(17)18)21-10(8-6-4-2)13(20,22-14)11(15)16/h3-4,9-12,19-20H,1-2,5-8H2/t9-,10+,13-,14-/m1/s1 |
| InChIKey | LWCUFHGSTMXBMJ-RDBQEKCUSA-N |
| XLogP | 2.61 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|