C10H24ClN3O3S — CID 119758899
2-methyl-3-(methylamino)-N-[2-(propan-2-ylsulfamoyl)ethyl]propanamide;hydrochloride (PubChem CID 119758899) has the molecular formula C10H24ClN3O3S and a molecular weight of 301.84 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[2-(propan-2-ylsulfamoyl)ethyl]propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-[2-(propan-2-ylsulfamoyl)ethyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119758899 |
| Molecular Formula | C10H24ClN3O3S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[2-(propan-2-ylsulfamoyl)ethyl]propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NCCS(=O)(=O)NC(C)C.Cl |
| InChI | InChI=1S/C10H23N3O3S.ClH/c1-8(2)13-17(15,16)6-5-12-10(14)9(3)7-11-4;/h8-9,11,13H,5-7H2,1-4H3,(H,12,14);1H |
| InChIKey | RENVLSHYNXSDGQ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |