C16H19FN4OS — CID 119759543
3-amino-N-[5-fluoro-2-(1-methylimidazol-2-yl)sulfanylphenyl]cyclopentane-1-carboxamide (PubChem CID 119759543) has the molecular formula C16H19FN4OS and a molecular weight of 334.42 g/mol. Its IUPAC name is 3-amino-N-[5-fluoro-2-(1-methylimidazol-2-yl)sulfanylphenyl]cyclopentane-1-carboxamide.
| Compound Name | 3-amino-N-[5-fluoro-2-(1-methylimidazol-2-yl)sulfanylphenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 119759543 |
| Molecular Formula | C16H19FN4OS |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-amino-N-[5-fluoro-2-(1-methylimidazol-2-yl)sulfanylphenyl]cyclopentane-1-carboxamide |
| SMILES | Cn1ccnc1Sc1ccc(F)cc1NC(=O)C1CCC(N)C1 |
| InChI | InChI=1S/C16H19FN4OS/c1-21-7-6-19-16(21)23-14-5-3-11(17)9-13(14)20-15(22)10-2-4-12(18)8-10/h3,5-7,9-10,12H,2,4,8,18H2,1H3,(H,20,22) |
| InChIKey | SMQHFQSWOFIFBV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |