C21H24F3NO3S — CID 11976084
3,4,5-trifluoro-N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide (PubChem CID 11976084) has the molecular formula C21H24F3NO3S and a molecular weight of 427.49 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | 3,4,5-trifluoro-N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11976084 |
| Molecular Formula | C21H24F3NO3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 3,4,5-trifluoro-N-[[1-[[4-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(Cc2ccc(CCO)cc2)CCCC1)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C21H24F3NO3S/c22-18-11-17(12-19(23)20(18)24)29(27,28)25-14-21(8-1-2-9-21)13-16-5-3-15(4-6-16)7-10-26/h3-6,11-12,25-26H,1-2,7-10,13-14H2 |
| InChIKey | HJEYGGKWWZMBKB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|