C17H19N3O3 — CID 119761839
N-[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]furan-3-carboxamide (PubChem CID 119761839) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]furan-3-carboxamide.
| Compound Name | N-[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 119761839 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N-[3-[(3-aminocyclopentanecarbonyl)amino]phenyl]furan-3-carboxamide |
| SMILES | NC1CCC(C(=O)Nc2cccc(NC(=O)c3ccoc3)c2)C1 |
| InChI | InChI=1S/C17H19N3O3/c18-13-5-4-11(8-13)16(21)19-14-2-1-3-15(9-14)20-17(22)12-6-7-23-10-12/h1-3,6-7,9-11,13H,4-5,8,18H2,(H,19,21)(H,20,22) |
| InChIKey | UHTYTKMHWMHQGJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |