About 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid
2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid (PubChem CID 11976184) has the molecular formula C14H23F2NO3S
and a molecular weight of 323.41 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid |
| PubChem CID | 11976184 |
| Molecular Formula | C14H23F2NO3S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid |
| SMILES | NCC(CC12CC3CC(C1)C(F)(F)C(C3)C2)CS(=O)(=O)O |
| InChI | InChI=1S/C14H23F2NO3S/c15-14(16)11-1-9-2-12(14)6-13(3-9,5-11)4-10(7-17)8-21(18,19)20/h9-12H,1-8,17H2,(H,18,19,20) |
| InChIKey | BYJSQKQLUBIMIP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid?
The IUPAC name of 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid (CID 11976184) is 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid.
What is the SMILES notation for 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid?
The canonical SMILES for 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid is NCC(CC12CC3CC(C1)C(F)(F)C(C3)C2)CS(=O)(=O)O.
What is the InChIKey of 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid?
The InChIKey is BYJSQKQLUBIMIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23F2NO3S/c15-14(16)11-1-9-2-12(14)6-13(3-9,5-11)4-10(7-17)8-21(18,19)20/h9-12H,1-8,17H2,(H,18,19,20).
What are the key properties of 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid?
2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid has a molecular weight of 323.41 g/mol, XLogP of 2.30, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-(4,4-difluoro-1-adamantyl)propane-1-sulfonic acid is sourced from PubChem (CID 11976184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).