C23H30ClN3O3 — CID 119762590
1-[4-[2-(4-aminophenyl)acetyl]-1,4-diazepan-1-yl]-3-(4-methoxyphenyl)propan-1-one;hydrochloride (PubChem CID 119762590) has the molecular formula C23H30ClN3O3 and a molecular weight of 431.96 g/mol. Its IUPAC name is 1-[4-[2-(4-aminophenyl)acetyl]-1,4-diazepan-1-yl]-3-(4-methoxyphenyl)propan-1-one;hydrochloride.
| Compound Name | 1-[4-[2-(4-aminophenyl)acetyl]-1,4-diazepan-1-yl]-3-(4-methoxyphenyl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119762590 |
| Molecular Formula | C23H30ClN3O3 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[4-[2-(4-aminophenyl)acetyl]-1,4-diazepan-1-yl]-3-(4-methoxyphenyl)propan-1-one;hydrochloride |
| SMILES | COc1ccc(CCC(=O)N2CCCN(C(=O)Cc3ccc(N)cc3)CC2)cc1.Cl |
| InChI | InChI=1S/C23H29N3O3.ClH/c1-29-21-10-5-18(6-11-21)7-12-22(27)25-13-2-14-26(16-15-25)23(28)17-19-3-8-20(24)9-4-19;/h3-6,8-11H,2,7,12-17,24H2,1H3;1H |
| InChIKey | XXIRJHHZZARIDV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|