C13H16BrN3O2 — CID 119762938
1-amino-N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]cyclopropane-1-carboxamide (PubChem CID 119762938) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is 1-amino-N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 119762938 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1-amino-N-[2-(5-bromo-2-methylanilino)-2-oxoethyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)CNC(=O)C1(N)CC1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-8-2-3-9(14)6-10(8)17-11(18)7-16-12(19)13(15)4-5-13/h2-3,6H,4-5,7,15H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | NGOPVVDVFHZYOZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |