C18H23NO — CID 11976350
3'-phenylspiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,5'-4H-1,2-oxazole] (PubChem CID 11976350) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 3'-phenylspiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,5'-4H-1,2-oxazole].
| Compound Name | 3'-phenylspiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,5'-4H-1,2-oxazole] |
|---|---|
| PubChem CID | 11976350 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3'-phenylspiro[2,3,4,4a,5,6,8,8a-octahydro-1H-naphthalene-7,5'-4H-1,2-oxazole] |
| SMILES | c1ccc(C2=NOC3(CCC4CCCCC4C3)C2)cc1 |
| InChI | InChI=1S/C18H23NO/c1-2-7-15(8-3-1)17-13-18(20-19-17)11-10-14-6-4-5-9-16(14)12-18/h1-3,7-8,14,16H,4-6,9-13H2 |
| InChIKey | MYDWRMZJKNGYGN-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |