C17H26ClN3O2 — CID 119766801
3-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]benzamide;hydrochloride (PubChem CID 119766801) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 3-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]benzamide;hydrochloride.
| Compound Name | 3-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 119766801 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-amino-N-[2-[(2-cyclohexylacetyl)amino]ethyl]benzamide;hydrochloride |
| SMILES | Cl.Nc1cccc(C(=O)NCCNC(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C17H25N3O2.ClH/c18-15-8-4-7-14(12-15)17(22)20-10-9-19-16(21)11-13-5-2-1-3-6-13;/h4,7-8,12-13H,1-3,5-6,9-11,18H2,(H,19,21)(H,20,22);1H |
| InChIKey | QOAMZTKNFOKIGG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|