C17H31N3O2 — CID 119767184
1-[(3-aminocyclohexanecarbonyl)amino]-N-propylcyclohexane-1-carboxamide (PubChem CID 119767184) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(3-aminocyclohexanecarbonyl)amino]-N-propylcyclohexane-1-carboxamide.
| Compound Name | 1-[(3-aminocyclohexanecarbonyl)amino]-N-propylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 119767184 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-[(3-aminocyclohexanecarbonyl)amino]-N-propylcyclohexane-1-carboxamide |
| SMILES | CCCNC(=O)C1(NC(=O)C2CCCC(N)C2)CCCCC1 |
| InChI | InChI=1S/C17H31N3O2/c1-2-11-19-16(22)17(9-4-3-5-10-17)20-15(21)13-7-6-8-14(18)12-13/h13-14H,2-12,18H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | PBFXCKJOXGVKCK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |